C22H28O12 — CID 44631112
dimethyl (1S,4S,5R,8R,11S,12R,14S,15R)-4,12,14-trihydroxy-6-[(E)-2-methylbut-2-enoyl]oxy-7-oxo-3,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadecane-4,11-dicarboxylate (PubChem CID 44631112) has the molecular formula C22H28O12 and a molecular weight of 484.45 g/mol. Its IUPAC name is dimethyl (1S,4S,5R,8R,11S,12R,14S,15R)-4,12,14-trihydroxy-6-[(E)-2-methylbut-2-enoyl]oxy-7-oxo-3,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadecane-4,11-dicarboxylate.
| Compound Name | dimethyl (1S,4S,5R,8R,11S,12R,14S,15R)-4,12,14-trihydroxy-6-[(E)-2-methylbut-2-enoyl]oxy-7-oxo-3,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadecane-4,11-dicarboxylate |
|---|---|
| PubChem CID | 44631112 |
| Molecular Formula | C22H28O12 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | dimethyl (1S,4S,5R,8R,11S,12R,14S,15R)-4,12,14-trihydroxy-6-[(E)-2-methylbut-2-enoyl]oxy-7-oxo-3,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadecane-4,11-dicarboxylate |
| SMILES | C/C=C(\C)C(=O)OC1C(=O)[C@@H]2OC[C@]3(C(=O)OC)[C@H](O)C[C@H](O)[C@@]4(CO[C@](O)(C(=O)OC)[C@@H]14)[C@@H]23 |
| InChI | InChI=1S/C22H28O12/c1-5-9(2)17(26)34-14-12(25)13-15-20(8-33-22(29,16(14)20)19(28)31-4)10(23)6-11(24)21(15,7-32-13)18(27)30-3/h5,10-11,13-16,23-24,29H,6-8H2,1-4H3/b9-5+/t10-,11+,13-,14?,15+,16-,20-,21-,22-/m0/s1 |
| InChIKey | XLOHWWDQEBIXAA-AJJWERCNSA-N |
| XLogP | -1.76 |
| TPSA | 175.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|