C10H9BrO3 — CID 44631145
(2Z,4E)-5-(5-bromofuran-2-yl)-3-methylpenta-2,4-dienoic acid (PubChem CID 44631145) has the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. Its IUPAC name is (2Z,4E)-5-(5-bromofuran-2-yl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-(5-bromofuran-2-yl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 44631145 |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | (2Z,4E)-5-(5-bromofuran-2-yl)-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(=C/C(=O)O)/C=C/c1ccc(Br)o1 |
| InChI | InChI=1S/C10H9BrO3/c1-7(6-10(12)13)2-3-8-4-5-9(11)14-8/h2-6H,1H3,(H,12,13)/b3-2+,7-6- |
| InChIKey | CMRKCTCWEAWEJD-OBJMPXFKSA-N |
| XLogP | 3.09 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|