C21H26N2O9 — CID 44631174
[(2R,3S,4R,5R,6S)-6-acetyl-3,4-diacetyloxy-5-(phenylcarbamoylamino)oxan-2-yl]methyl acetate (PubChem CID 44631174) has the molecular formula C21H26N2O9 and a molecular weight of 450.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-acetyl-3,4-diacetyloxy-5-(phenylcarbamoylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-acetyl-3,4-diacetyloxy-5-(phenylcarbamoylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 44631174 |
| Molecular Formula | C21H26N2O9 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-acetyl-3,4-diacetyloxy-5-(phenylcarbamoylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C(C)=O)[C@H](NC(=O)Nc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H26N2O9/c1-11(24)18-17(23-21(28)22-15-8-6-5-7-9-15)20(31-14(4)27)19(30-13(3)26)16(32-18)10-29-12(2)25/h5-9,16-20H,10H2,1-4H3,(H2,22,23,28)/t16-,17+,18-,19-,20-/m1/s1 |
| InChIKey | NPECICKETFLYMT-USYVTKNRSA-N |
| XLogP | 0.96 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|