C18H28N2O3S — CID 44631351
N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]hexyl]-N-methylbenzenesulfonamide (PubChem CID 44631351) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]hexyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]hexyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 44631351 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]hexyl]-N-methylbenzenesulfonamide |
| SMILES | CC[C@@H]1COC(C(C)CCCCN(C)S(=O)(=O)c2ccccc2)=N1 |
| InChI | InChI=1S/C18H28N2O3S/c1-4-16-14-23-18(19-16)15(2)10-8-9-13-20(3)24(21,22)17-11-6-5-7-12-17/h5-7,11-12,15-16H,4,8-10,13-14H2,1-3H3/t15?,16-/m1/s1 |
| InChIKey | OETDVPUQZYGHRA-OEMAIJDKSA-N |
| XLogP | 3.32 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|