C20H32N2O3S — CID 44631368
N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]-6-methylheptyl]-N-methylbenzenesulfonamide (PubChem CID 44631368) has the molecular formula C20H32N2O3S and a molecular weight of 380.55 g/mol. Its IUPAC name is N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]-6-methylheptyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]-6-methylheptyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 44631368 |
| Molecular Formula | C20H32N2O3S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]-6-methylheptyl]-N-methylbenzenesulfonamide |
| SMILES | CC[C@@H]1COC(C(CCCCN(C)S(=O)(=O)c2ccccc2)C(C)C)=N1 |
| InChI | InChI=1S/C20H32N2O3S/c1-5-17-15-25-20(21-17)19(16(2)3)13-9-10-14-22(4)26(23,24)18-11-7-6-8-12-18/h6-8,11-12,16-17,19H,5,9-10,13-15H2,1-4H3/t17-,19?/m1/s1 |
| InChIKey | BFVBALFTFHELGN-DUSLRRAJSA-N |
| XLogP | 3.96 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|