About (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene]
(2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene] (PubChem CID 44631374) has the molecular formula C17H16O
and a molecular weight of 236.31 g/mol. Its IUPAC name is (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene].
Molecular Properties
| Compound Name | (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene] |
| PubChem CID | 44631374 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene] |
| SMILES | CCO[C@@H]1CC12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C17H16O/c1-2-18-16-11-17(16)14-9-5-3-7-12(14)13-8-4-6-10-15(13)17/h3-10,16H,2,11H2,1H3/t16-/m1/s1 |
| InChIKey | SMGFQEURSSFQSW-MRXNPFEDSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene]?
The IUPAC name of (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene] (CID 44631374) is (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene].
What is the SMILES notation for (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene]?
The canonical SMILES for (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene] is CCO[C@@H]1CC12c1ccccc1-c1ccccc12.
What is the InChIKey of (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene]?
The InChIKey is SMGFQEURSSFQSW-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H16O/c1-2-18-16-11-17(16)14-9-5-3-7-12(14)13-8-4-6-10-15(13)17/h3-10,16H,2,11H2,1H3/t16-/m1/s1.
What are the key properties of (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene]?
(2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene] has a molecular weight of 236.31 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-ethoxyspiro[cyclopropane-1,9'-fluorene] is sourced from PubChem (CID 44631374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).