C24H40N2O3S — CID 44631376
N-[11-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]dodecyl]-N-methylbenzenesulfonamide (PubChem CID 44631376) has the molecular formula C24H40N2O3S and a molecular weight of 436.66 g/mol. Its IUPAC name is N-[11-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]dodecyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[11-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]dodecyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 44631376 |
| Molecular Formula | C24H40N2O3S |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | N-[11-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]dodecyl]-N-methylbenzenesulfonamide |
| SMILES | CC[C@@H]1COC(C(C)CCCCCCCCCCN(C)S(=O)(=O)c2ccccc2)=N1 |
| InChI | InChI=1S/C24H40N2O3S/c1-4-22-20-29-24(25-22)21(2)16-12-9-7-5-6-8-10-15-19-26(3)30(27,28)23-17-13-11-14-18-23/h11,13-14,17-18,21-22H,4-10,12,15-16,19-20H2,1-3H3/t21?,22-/m1/s1 |
| InChIKey | QEIJAKCFWJMTEM-FOIFJWKZSA-N |
| XLogP | 5.66 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|