C19H30N2O3S — CID 44631393
N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]heptyl]-N-methylbenzenesulfonamide (PubChem CID 44631393) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]heptyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]heptyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 44631393 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]heptyl]-N-methylbenzenesulfonamide |
| SMILES | CCC(CCCCN(C)S(=O)(=O)c1ccccc1)C1=N[C@H](CC)CO1 |
| InChI | InChI=1S/C19H30N2O3S/c1-4-16(19-20-17(5-2)15-24-19)11-9-10-14-21(3)25(22,23)18-12-7-6-8-13-18/h6-8,12-13,16-17H,4-5,9-11,14-15H2,1-3H3/t16?,17-/m1/s1 |
| InChIKey | NEKNIRDPNKGRGZ-ZYMOGRSISA-N |
| XLogP | 3.71 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|