C21H36O7 — CID 44631436
(1R,2S,3S,4R,7R,8R,9S,10R,12R,14S)-7-ethyl-3,9,14-trihydroxy-2,4,8,10,12,14-hexamethyl-6,15-dioxabicyclo[10.2.1]pentadecane-5,11-dione (PubChem CID 44631436) has the molecular formula C21H36O7 and a molecular weight of 400.51 g/mol. Its IUPAC name is (1R,2S,3S,4R,7R,8R,9S,10R,12R,14S)-7-ethyl-3,9,14-trihydroxy-2,4,8,10,12,14-hexamethyl-6,15-dioxabicyclo[10.2.1]pentadecane-5,11-dione.
| Compound Name | (1R,2S,3S,4R,7R,8R,9S,10R,12R,14S)-7-ethyl-3,9,14-trihydroxy-2,4,8,10,12,14-hexamethyl-6,15-dioxabicyclo[10.2.1]pentadecane-5,11-dione |
|---|---|
| PubChem CID | 44631436 |
| Molecular Formula | C21H36O7 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (1R,2S,3S,4R,7R,8R,9S,10R,12R,14S)-7-ethyl-3,9,14-trihydroxy-2,4,8,10,12,14-hexamethyl-6,15-dioxabicyclo[10.2.1]pentadecane-5,11-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@H]2O[C@](C)(C[C@]2(C)O)C(=O)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C21H36O7/c1-8-14-10(2)15(22)11(3)17(24)21(7)9-20(6,26)18(28-21)12(4)16(23)13(5)19(25)27-14/h10-16,18,22-23,26H,8-9H2,1-7H3/t10-,11+,12-,13+,14+,15-,16-,18+,20-,21+/m0/s1 |
| InChIKey | XFNHIMPGVVXAIY-MELDDIDPSA-N |
| XLogP | 1.46 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |