About N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide
N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide (PubChem CID 44631446) has the molecular formula C16H24N2O3S
and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide |
| PubChem CID | 44631446 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide |
| SMILES | CC[C@@H]1COC(C(C)CCN(C)S(=O)(=O)c2ccccc2)=N1 |
| InChI | InChI=1S/C16H24N2O3S/c1-4-14-12-21-16(17-14)13(2)10-11-18(3)22(19,20)15-8-6-5-7-9-15/h5-9,13-14H,4,10-12H2,1-3H3/t13?,14-/m1/s1 |
| InChIKey | XKNYJWRPOFIQFG-ARLHGKGLSA-N |
| XLogP | 2.54 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide?
The IUPAC name of N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide (CID 44631446) is N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide.
What is the SMILES notation for N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide?
The canonical SMILES for N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide is CC[C@@H]1COC(C(C)CCN(C)S(=O)(=O)c2ccccc2)=N1.
What is the InChIKey of N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide?
The InChIKey is XKNYJWRPOFIQFG-ARLHGKGLSA-N. The full InChI is InChI=1S/C16H24N2O3S/c1-4-14-12-21-16(17-14)13(2)10-11-18(3)22(19,20)15-8-6-5-7-9-15/h5-9,13-14H,4,10-12H2,1-3H3/t13?,14-/m1/s1.
What are the key properties of N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide?
N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide has a molecular weight of 324.45 g/mol, XLogP of 2.54, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]butyl]-N-methylbenzenesulfonamide is sourced from PubChem (CID 44631446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).