C11H16O — CID 44631602
6-prop-1-en-2-yl-2,3,5,6,7,7a-hexahydro-1-benzofuran (PubChem CID 44631602) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 6-prop-1-en-2-yl-2,3,5,6,7,7a-hexahydro-1-benzofuran.
| Compound Name | 6-prop-1-en-2-yl-2,3,5,6,7,7a-hexahydro-1-benzofuran |
|---|---|
| PubChem CID | 44631602 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 6-prop-1-en-2-yl-2,3,5,6,7,7a-hexahydro-1-benzofuran |
| SMILES | C=C(C)C1CC=C2CCOC2C1 |
| InChI | InChI=1S/C11H16O/c1-8(2)10-4-3-9-5-6-12-11(9)7-10/h3,10-11H,1,4-7H2,2H3 |
| InChIKey | SRTKAWYNHRFNEJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|