C15H19FO4 — CID 44631660
4-[fluoro(phenylmethoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 44631660) has the molecular formula C15H19FO4 and a molecular weight of 282.31 g/mol. Its IUPAC name is 4-[fluoro(phenylmethoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | 4-[fluoro(phenylmethoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 44631660 |
| Molecular Formula | C15H19FO4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 4-[fluoro(phenylmethoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CC1(C)OC2COC(C(F)OCc3ccccc3)C2O1 |
| InChI | InChI=1S/C15H19FO4/c1-15(2)19-11-9-17-13(12(11)20-15)14(16)18-8-10-6-4-3-5-7-10/h3-7,11-14H,8-9H2,1-2H3 |
| InChIKey | ZNBSQFUJYDJWLM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |