C21H23N5 — CID 44631783
N-(cyclohexylmethyl)-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine (PubChem CID 44631783) has the molecular formula C21H23N5 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine.
| Compound Name | N-(cyclohexylmethyl)-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 44631783 |
| Molecular Formula | C21H23N5 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N-(cyclohexylmethyl)-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine |
| SMILES | c1ccc(-c2nnc(-c3ccccn3)nc2NCC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H23N5/c1-3-9-16(10-4-1)15-23-21-19(17-11-5-2-6-12-17)25-26-20(24-21)18-13-7-8-14-22-18/h2,5-8,11-14,16H,1,3-4,9-10,15H2,(H,23,24,26) |
| InChIKey | FTHAFMYRINDSEL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |