C20H23N5 — CID 44631784
N-(3,3-dimethylbutyl)-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine (PubChem CID 44631784) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine.
| Compound Name | N-(3,3-dimethylbutyl)-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 44631784 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | N-(3,3-dimethylbutyl)-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine |
| SMILES | CC(C)(C)CCNc1nc(-c2ccccn2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C20H23N5/c1-20(2,3)12-14-22-19-17(15-9-5-4-6-10-15)24-25-18(23-19)16-11-7-8-13-21-16/h4-11,13H,12,14H2,1-3H3,(H,22,23,25) |
| InChIKey | VZQQBRATUAQGEU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |