C17H18ClN5O4 — CID 44631906
(1R,2S,3R,5R)-3-[(2-amino-6-chloro-5-furo[2,3-c]pyridin-2-ylpyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 44631906) has the molecular formula C17H18ClN5O4 and a molecular weight of 391.82 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[(2-amino-6-chloro-5-furo[2,3-c]pyridin-2-ylpyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[(2-amino-6-chloro-5-furo[2,3-c]pyridin-2-ylpyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 44631906 |
| Molecular Formula | C17H18ClN5O4 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (1R,2S,3R,5R)-3-[(2-amino-6-chloro-5-furo[2,3-c]pyridin-2-ylpyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Nc1nc(Cl)c(-c2cc3ccncc3o2)c(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C17H18ClN5O4/c18-15-12(10-4-7-1-2-20-5-11(7)27-10)16(23-17(19)22-15)21-9-3-8(6-24)13(25)14(9)26/h1-2,4-5,8-9,13-14,24-26H,3,6H2,(H3,19,21,22,23)/t8-,9-,13-,14+/m1/s1 |
| InChIKey | WTQVQBWOPQUNTJ-NTKGCBCNSA-N |
| XLogP | 1.03 |
| TPSA | 150.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |