C15H32O3SiSn — CID 44632392
methyl (Z,2R)-2-triethylsilyloxy-5-trimethylstannylpent-4-enoate (PubChem CID 44632392) has the molecular formula C15H32O3SiSn and a molecular weight of 407.22 g/mol. Its IUPAC name is methyl (Z,2R)-2-triethylsilyloxy-5-trimethylstannylpent-4-enoate.
| Compound Name | methyl (Z,2R)-2-triethylsilyloxy-5-trimethylstannylpent-4-enoate |
|---|---|
| PubChem CID | 44632392 |
| Molecular Formula | C15H32O3SiSn |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | methyl (Z,2R)-2-triethylsilyloxy-5-trimethylstannylpent-4-enoate |
| SMILES | CC[Si](CC)(CC)O[C@H](C/C=C\[Sn](C)(C)C)C(=O)OC |
| InChI | InChI=1S/C12H23O3Si.3CH3.Sn/c1-6-10-11(12(13)14-5)15-16(7-2,8-3)9-4;;;;/h1,6,11H,7-10H2,2-5H3;3*1H3;/t11-;;;;/m1..../s1 |
| InChIKey | LZIDGQOBVUZTCA-LOSFGHDGSA-N |
| XLogP | 4.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|