C36H46F6N14O6 — CID 44632501
4-N,6-N-bis[2-(2-aminoethoxy)-3-[5-(diaminomethylideneamino)pentanoylamino]-5-(trifluoromethyl)phenyl]pyrimidine-4,6-dicarboxamide (PubChem CID 44632501) has the molecular formula C36H46F6N14O6 and a molecular weight of 884.84 g/mol. Its IUPAC name is 4-N,6-N-bis[2-(2-aminoethoxy)-3-[5-(diaminomethylideneamino)pentanoylamino]-5-(trifluoromethyl)phenyl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N,6-N-bis[2-(2-aminoethoxy)-3-[5-(diaminomethylideneamino)pentanoylamino]-5-(trifluoromethyl)phenyl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 44632501 |
| Molecular Formula | C36H46F6N14O6 |
| Molecular Weight | 884.84 g/mol |
| Exact Mass | 884.36 |
| IUPAC Name | 4-N,6-N-bis[2-(2-aminoethoxy)-3-[5-(diaminomethylideneamino)pentanoylamino]-5-(trifluoromethyl)phenyl]pyrimidine-4,6-dicarboxamide |
| SMILES | NCCOc1c(NC(=O)CCCCN=C(N)N)cc(C(F)(F)F)cc1NC(=O)c1cc(C(=O)Nc2cc(C(F)(F)F)cc(NC(=O)CCCCN=C(N)N)c2OCCN)ncn1 |
| InChI | InChI=1S/C36H46F6N14O6/c37-35(38,39)19-13-21(53-27(57)5-1-3-9-49-33(45)46)29(61-11-7-43)23(15-19)55-31(59)25-17-26(52-18-51-25)32(60)56-24-16-20(36(40,41)42)14-22(30(24)62-12-8-44)54-28(58)6-2-4-10-50-34(47)48/h13-18H,1-12,43-44H2,(H,53,57)(H,54,58)(H,55,59)(H,56,60)(H4,45,46,49)(H4,47,48,50) |
| InChIKey | GHWGZKKAQCGHFA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 341.48 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.84 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|