C27H22F10N4O4S — CID 44632527
6-N-[4-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-2-methylphenyl]-2,2,3,3-tetrafluoro-5-N-[(2R)-1-methylsulfanylpropan-2-yl]-1,4-benzodioxine-5,6-dicarboxamide (PubChem CID 44632527) has the molecular formula C27H22F10N4O4S and a molecular weight of 688.54 g/mol. Its IUPAC name is 6-N-[4-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-2-methylphenyl]-2,2,3,3-tetrafluoro-5-N-[(2R)-1-methylsulfanylpropan-2-yl]-1,4-benzodioxine-5,6-dicarboxamide.
| Compound Name | 6-N-[4-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-2-methylphenyl]-2,2,3,3-tetrafluoro-5-N-[(2R)-1-methylsulfanylpropan-2-yl]-1,4-benzodioxine-5,6-dicarboxamide |
|---|---|
| PubChem CID | 44632527 |
| Molecular Formula | C27H22F10N4O4S |
| Molecular Weight | 688.54 g/mol |
| Exact Mass | 688.12 |
| IUPAC Name | 6-N-[4-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-2-methylphenyl]-2,2,3,3-tetrafluoro-5-N-[(2R)-1-methylsulfanylpropan-2-yl]-1,4-benzodioxine-5,6-dicarboxamide |
| SMILES | CSC[C@@H](C)NC(=O)c1c(C(=O)Nc2ccc(Cn3nc(C(F)(F)F)cc3C(F)(F)F)cc2C)ccc2c1OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C27H22F10N4O4S/c1-12-8-14(10-41-19(25(31,32)33)9-18(40-41)24(28,29)30)4-6-16(12)39-22(42)15-5-7-17-21(45-27(36,37)26(34,35)44-17)20(15)23(43)38-13(2)11-46-3/h4-9,13H,10-11H2,1-3H3,(H,38,43)(H,39,42)/t13-/m1/s1 |
| InChIKey | IYUFBFFZTNXYLI-CYBMUJFWSA-N |
| XLogP | 6.97 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.54 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|