C26H24N8O3 — CID 44632861
N'-(4-nitro-2,1,3-benzoxadiazol-7-yl)-N,N,N'-tris(pyridin-2-ylmethyl)ethane-1,2-diamine (PubChem CID 44632861) has the molecular formula C26H24N8O3 and a molecular weight of 496.53 g/mol. Its IUPAC name is N'-(4-nitro-2,1,3-benzoxadiazol-7-yl)-N,N,N'-tris(pyridin-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(4-nitro-2,1,3-benzoxadiazol-7-yl)-N,N,N'-tris(pyridin-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 44632861 |
| Molecular Formula | C26H24N8O3 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N'-(4-nitro-2,1,3-benzoxadiazol-7-yl)-N,N,N'-tris(pyridin-2-ylmethyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(N(CCN(Cc2ccccn2)Cc2ccccn2)Cc2ccccn2)c2nonc12 |
| InChI | InChI=1S/C26H24N8O3/c35-34(36)24-11-10-23(25-26(24)31-37-30-25)33(19-22-9-3-6-14-29-22)16-15-32(17-20-7-1-4-12-27-20)18-21-8-2-5-13-28-21/h1-14H,15-19H2 |
| InChIKey | WBROPDACWHVGSC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 127.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|