C42H40F3NO8 — CID 44633026
2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 44633026) has the molecular formula C42H40F3NO8 and a molecular weight of 743.77 g/mol. Its IUPAC name is 2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 44633026 |
| Molecular Formula | C42H40F3NO8 |
| Molecular Weight | 743.77 g/mol |
| Exact Mass | 743.27 |
| IUPAC Name | 2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | C[C@@H](NCCCc1cccc(C(F)(F)F)c1)c1cccc2ccccc12.Cc1ccc(C(=O)OC(C(=O)O)C(OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H22F3N.C20H18O8/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25;1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3;3-10,15-16H,1-2H3,(H,21,22)(H,23,24)/t16-;/m1./s1 |
| InChIKey | AJIBGZKQOAVKEB-PKLMIRHRSA-N |
| XLogP | 8.37 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.77 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|