6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid

C11H6Cl2N2O2 — CID 44633034

IUPAC6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(Cl)c(Cl)c2)ncn1
InChIInChI=1S/C11H6Cl2N2O2/c12-7-2-1-6(3-8(7)13)9-4-10(11(16)17)15-5-14-9/h1-5H,(H,16,17)
InChIKeyFPVPSYCVUOIXCH-UHFFFAOYSA-N
MW269.09 g/mol
LogP3.15
Rot. Bonds2

About 6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid

6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid (PubChem CID 44633034) has the molecular formula C11H6Cl2N2O2 and a molecular weight of 269.09 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid.

Molecular Properties

Compound Name6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid
PubChem CID44633034
Molecular FormulaC11H6Cl2N2O2
Molecular Weight269.09 g/mol
Exact Mass267.98
IUPAC Name6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(Cl)c(Cl)c2)ncn1
InChIInChI=1S/C11H6Cl2N2O2/c12-7-2-1-6(3-8(7)13)9-4-10(11(16)17)15-5-14-9/h1-5H,(H,16,17)
InChIKeyFPVPSYCVUOIXCH-UHFFFAOYSA-N
XLogP3.15
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.09
LogP ≤ 53.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid?
The IUPAC name of 6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid (CID 44633034) is 6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid.
What is the SMILES notation for 6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid?
The canonical SMILES for 6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid is O=C(O)c1cc(-c2ccc(Cl)c(Cl)c2)ncn1.
What is the InChIKey of 6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid?
The InChIKey is FPVPSYCVUOIXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl2N2O2/c12-7-2-1-6(3-8(7)13)9-4-10(11(16)17)15-5-14-9/h1-5H,(H,16,17).
What are the key properties of 6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid?
6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid has a molecular weight of 269.09 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dichlorophenyl)pyrimidine-4-carboxylic acid is sourced from PubChem (CID 44633034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).