About 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid
6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid (PubChem CID 44633501) has the molecular formula C11H6F2N2O2
and a molecular weight of 236.18 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid |
| PubChem CID | 44633501 |
| Molecular Formula | C11H6F2N2O2 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(F)cc2F)ncn1 |
| InChI | InChI=1S/C11H6F2N2O2/c12-6-1-2-7(8(13)3-6)9-4-10(11(16)17)15-5-14-9/h1-5H,(H,16,17) |
| InChIKey | UCSDZWHRNJQLJC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid?
The IUPAC name of 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid (CID 44633501) is 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid.
What is the SMILES notation for 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid?
The canonical SMILES for 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid is O=C(O)c1cc(-c2ccc(F)cc2F)ncn1.
What is the InChIKey of 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid?
The InChIKey is UCSDZWHRNJQLJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F2N2O2/c12-6-1-2-7(8(13)3-6)9-4-10(11(16)17)15-5-14-9/h1-5H,(H,16,17).
What are the key properties of 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid?
6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid has a molecular weight of 236.18 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-difluorophenyl)pyrimidine-4-carboxylic acid is sourced from PubChem (CID 44633501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).