C30H58N2O5Si3 — CID 44633535
6-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-methylpyridine-2-carboxamide (PubChem CID 44633535) has the molecular formula C30H58N2O5Si3 and a molecular weight of 611.06 g/mol. Its IUPAC name is 6-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 6-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 44633535 |
| Molecular Formula | C30H58N2O5Si3 |
| Molecular Weight | 611.06 g/mol |
| Exact Mass | 610.37 |
| IUPAC Name | 6-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cccc([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C30H58N2O5Si3/c1-28(2,3)38(11,12)34-20-23-25(36-39(13,14)29(4,5)6)26(37-40(15,16)30(7,8)9)24(35-23)21-18-17-19-22(32-21)27(33)31-10/h17-19,23-26H,20H2,1-16H3,(H,31,33)/t23-,24+,25-,26+/m1/s1 |
| InChIKey | ZKOPGPDHFLPHSA-ZJSPYRCASA-N |
| XLogP | 7.68 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.06 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|