C30H26Cl2O5S2 — CID 44633835
ethyl (2R,4R,6R,7S)-4-(4-chlorobenzoyl)-7-(4-chlorophenyl)-2-(4-methylphenyl)-5,5-dioxo-3,4,6,7-tetrahydro-2H-thieno[3,2-c]thiopyran-6-carboxylate (PubChem CID 44633835) has the molecular formula C30H26Cl2O5S2 and a molecular weight of 601.57 g/mol. Its IUPAC name is ethyl (2R,4R,6R,7S)-4-(4-chlorobenzoyl)-7-(4-chlorophenyl)-2-(4-methylphenyl)-5,5-dioxo-3,4,6,7-tetrahydro-2H-thieno[3,2-c]thiopyran-6-carboxylate.
| Compound Name | ethyl (2R,4R,6R,7S)-4-(4-chlorobenzoyl)-7-(4-chlorophenyl)-2-(4-methylphenyl)-5,5-dioxo-3,4,6,7-tetrahydro-2H-thieno[3,2-c]thiopyran-6-carboxylate |
|---|---|
| PubChem CID | 44633835 |
| Molecular Formula | C30H26Cl2O5S2 |
| Molecular Weight | 601.57 g/mol |
| Exact Mass | 600.06 |
| IUPAC Name | ethyl (2R,4R,6R,7S)-4-(4-chlorobenzoyl)-7-(4-chlorophenyl)-2-(4-methylphenyl)-5,5-dioxo-3,4,6,7-tetrahydro-2H-thieno[3,2-c]thiopyran-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](c2ccc(Cl)cc2)C2=C(C[C@H](c3ccc(C)cc3)S2)[C@H](C(=O)c2ccc(Cl)cc2)S1(=O)=O |
| InChI | InChI=1S/C30H26Cl2O5S2/c1-3-37-30(34)29-25(19-8-12-21(31)13-9-19)27-23(16-24(38-27)18-6-4-17(2)5-7-18)28(39(29,35)36)26(33)20-10-14-22(32)15-11-20/h4-15,24-25,28-29H,3,16H2,1-2H3/t24-,25-,28-,29-/m1/s1 |
| InChIKey | CARGNKKDXMFLPC-WPUBFDFZSA-N |
| XLogP | 7.13 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.57 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |