C12H14N4O8 — CID 44633880
(3S,4S,5R,6S)-6-(hydroxymethyl)-3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-2,4,5-triol (PubChem CID 44633880) has the molecular formula C12H14N4O8 and a molecular weight of 342.26 g/mol. Its IUPAC name is (3S,4S,5R,6S)-6-(hydroxymethyl)-3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-2,4,5-triol.
| Compound Name | (3S,4S,5R,6S)-6-(hydroxymethyl)-3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-2,4,5-triol |
|---|---|
| PubChem CID | 44633880 |
| Molecular Formula | C12H14N4O8 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (3S,4S,5R,6S)-6-(hydroxymethyl)-3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-2,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc(N[C@@H]2C(O)O[C@@H](CO)[C@H](O)[C@H]2O)c2nonc12 |
| InChI | InChI=1S/C12H14N4O8/c17-3-6-10(18)11(19)9(12(20)23-6)13-4-1-2-5(16(21)22)8-7(4)14-24-15-8/h1-2,6,9-13,17-20H,3H2/t6-,9-,10-,11-,12?/m0/s1 |
| InChIKey | GVEBOQDOPLERMC-DHXNPPAISA-N |
| XLogP | -1.66 |
| TPSA | 184.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|