C24H21N3O3 — CID 44634186
3,3-dimethyl-6-[(2-nitrophenyl)methyl]-4,7-dihydro-2H-indolo[2,3-c]quinolin-1-one (PubChem CID 44634186) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3,3-dimethyl-6-[(2-nitrophenyl)methyl]-4,7-dihydro-2H-indolo[2,3-c]quinolin-1-one.
| Compound Name | 3,3-dimethyl-6-[(2-nitrophenyl)methyl]-4,7-dihydro-2H-indolo[2,3-c]quinolin-1-one |
|---|---|
| PubChem CID | 44634186 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3,3-dimethyl-6-[(2-nitrophenyl)methyl]-4,7-dihydro-2H-indolo[2,3-c]quinolin-1-one |
| SMILES | CC1(C)CC(=O)c2c(nc(Cc3ccccc3[N+](=O)[O-])c3[nH]c4ccccc4c23)C1 |
| InChI | InChI=1S/C24H21N3O3/c1-24(2)12-18-22(20(28)13-24)21-15-8-4-5-9-16(15)26-23(21)17(25-18)11-14-7-3-6-10-19(14)27(29)30/h3-10,26H,11-13H2,1-2H3 |
| InChIKey | AAMWOORDGUNZKO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|