C29H23N3O3 — CID 44634504
15,18-bis(3-methoxyphenyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-16-imine (PubChem CID 44634504) has the molecular formula C29H23N3O3 and a molecular weight of 461.52 g/mol. Its IUPAC name is 15,18-bis(3-methoxyphenyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-16-imine.
| Compound Name | 15,18-bis(3-methoxyphenyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-16-imine |
|---|---|
| PubChem CID | 44634504 |
| Molecular Formula | C29H23N3O3 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 15,18-bis(3-methoxyphenyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-16-imine |
| SMILES | [H]/N=c1/c2c(ncn1-c1cccc(OC)c1)Oc1ccc3ccccc3c1C2c1cccc(OC)c1 |
| InChI | InChI=1S/C29H23N3O3/c1-33-21-10-5-8-19(15-21)25-26-23-12-4-3-7-18(23)13-14-24(26)35-29-27(25)28(30)32(17-31-29)20-9-6-11-22(16-20)34-2/h3-17,25,30H,1-2H3/b30-28- |
| InChIKey | UGPMTEHNCAFYDK-HYOGKJQXSA-N |
| XLogP | 5.81 |
| TPSA | 69.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |