C29H20N4O2 — CID 44634517
3-[16-imino-18-(3-methoxyphenyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-15-yl]benzonitrile (PubChem CID 44634517) has the molecular formula C29H20N4O2 and a molecular weight of 456.51 g/mol. Its IUPAC name is 3-[16-imino-18-(3-methoxyphenyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-15-yl]benzonitrile.
| Compound Name | 3-[16-imino-18-(3-methoxyphenyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-15-yl]benzonitrile |
|---|---|
| PubChem CID | 44634517 |
| Molecular Formula | C29H20N4O2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[16-imino-18-(3-methoxyphenyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),13-heptaen-15-yl]benzonitrile |
| SMILES | [H]/N=c1/c2c(ncn1-c1cccc(C#N)c1)Oc1ccc3ccccc3c1C2c1cccc(OC)c1 |
| InChI | InChI=1S/C29H20N4O2/c1-34-22-10-5-8-20(15-22)25-26-23-11-3-2-7-19(23)12-13-24(26)35-29-27(25)28(31)33(17-32-29)21-9-4-6-18(14-21)16-30/h2-15,17,25,31H,1H3/b31-28- |
| InChIKey | KUDNLFVMHPGYMU-PNOGMODKSA-N |
| XLogP | 5.67 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |