About (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol
(1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol (PubChem CID 44634524) has the molecular formula C22H21N2O+
and a molecular weight of 329.42 g/mol. Its IUPAC name is (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol.
Molecular Properties
| Compound Name | (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol |
| PubChem CID | 44634524 |
| Molecular Formula | C22H21N2O+ |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol |
| SMILES | Cc1c(C(O)(c2ccccc2)c2ccccc2)[n+]2ccccc2n1C |
| InChI | InChI=1S/C22H21N2O/c1-17-21(24-16-10-9-15-20(24)23(17)2)22(25,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-16,25H,1-2H3/q+1 |
| InChIKey | HCXOEMCJMXYNEF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol?
The IUPAC name of (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol (CID 44634524) is (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol.
What is the SMILES notation for (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol?
The canonical SMILES for (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol is Cc1c(C(O)(c2ccccc2)c2ccccc2)[n+]2ccccc2n1C.
What is the InChIKey of (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol?
The InChIKey is HCXOEMCJMXYNEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N2O/c1-17-21(24-16-10-9-15-20(24)23(17)2)22(25,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-16,25H,1-2H3/q+1.
What are the key properties of (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol?
(1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol has a molecular weight of 329.42 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-3-yl)-diphenylmethanol is sourced from PubChem (CID 44634524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).