C32H29N3O3 — CID 44634568
18-(3,4-dimethoxyphenyl)-13-(3-phenylpropyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),14-heptaen-16-imine (PubChem CID 44634568) has the molecular formula C32H29N3O3 and a molecular weight of 503.60 g/mol. Its IUPAC name is 18-(3,4-dimethoxyphenyl)-13-(3-phenylpropyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),14-heptaen-16-imine.
| Compound Name | 18-(3,4-dimethoxyphenyl)-13-(3-phenylpropyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),14-heptaen-16-imine |
|---|---|
| PubChem CID | 44634568 |
| Molecular Formula | C32H29N3O3 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 18-(3,4-dimethoxyphenyl)-13-(3-phenylpropyl)-11-oxa-13,15-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),14-heptaen-16-imine |
| SMILES | [H]/N=c1\ncn(CCCc2ccccc2)c2c1C(c1ccc(OC)c(OC)c1)c1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C32H29N3O3/c1-36-25-16-15-23(19-27(25)37-2)28-29-24-13-7-6-12-22(24)14-17-26(29)38-32-30(28)31(33)34-20-35(32)18-8-11-21-9-4-3-5-10-21/h3-7,9-10,12-17,19-20,28,33H,8,11,18H2,1-2H3/b33-31- |
| InChIKey | WCSXHXVIGMPUNF-FPODKLOTSA-N |
| XLogP | 6.45 |
| TPSA | 69.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |