C18H28N2O3 — CID 44634605
8-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-8-oxooctanoic acid (PubChem CID 44634605) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 8-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-8-oxooctanoic acid.
| Compound Name | 8-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 44634605 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 8-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-8-oxooctanoic acid |
| SMILES | CC1(C)[C@H]2CC=C(/C=N\NC(=O)CCCCCCC(=O)O)[C@@H]1C2 |
| InChI | InChI=1S/C18H28N2O3/c1-18(2)14-10-9-13(15(18)11-14)12-19-20-16(21)7-5-3-4-6-8-17(22)23/h9,12,14-15H,3-8,10-11H2,1-2H3,(H,20,21)(H,22,23)/b19-12-/t14-,15-/m0/s1 |
| InChIKey | KBCQEQYJOFBYTJ-UMAUMKHOSA-N |
| XLogP | 3.51 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|