C17H26N2O3 — CID 44634638
7-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-7-oxoheptanoic acid (PubChem CID 44634638) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 7-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-7-oxoheptanoic acid.
| Compound Name | 7-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 44634638 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 7-[(2Z)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]-7-oxoheptanoic acid |
| SMILES | CC1(C)[C@H]2CC=C(/C=N\NC(=O)CCCCCC(=O)O)[C@@H]1C2 |
| InChI | InChI=1S/C17H26N2O3/c1-17(2)13-9-8-12(14(17)10-13)11-18-19-15(20)6-4-3-5-7-16(21)22/h8,11,13-14H,3-7,9-10H2,1-2H3,(H,19,20)(H,21,22)/b18-11-/t13-,14-/m0/s1 |
| InChIKey | BNIBVFHELCEFBN-HCQLAHMTSA-N |
| XLogP | 3.12 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|