C16H25N3O3 — CID 44634710
N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-N'-hydroxyhexanediamide (PubChem CID 44634710) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-N'-hydroxyhexanediamide.
| Compound Name | N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 44634710 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-N'-hydroxyhexanediamide |
| SMILES | CC1(C)[C@H]2CC=C(/C=N\NC(=O)CCCCC(=O)NO)[C@@H]1C2 |
| InChI | InChI=1S/C16H25N3O3/c1-16(2)12-8-7-11(13(16)9-12)10-17-18-14(20)5-3-4-6-15(21)19-22/h7,10,12-13,22H,3-6,8-9H2,1-2H3,(H,18,20)(H,19,21)/b17-10-/t12-,13-/m0/s1 |
| InChIKey | LVHPCABZUDULIG-WKUUQJLDSA-N |
| XLogP | 2.15 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|