C19H23N3O3S — CID 44634848
6-(dimethylamino)-N-(3,4-dimethylphenyl)-2-oxo-3,4-dihydro-1H-quinoline-7-sulfonamide (PubChem CID 44634848) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 6-(dimethylamino)-N-(3,4-dimethylphenyl)-2-oxo-3,4-dihydro-1H-quinoline-7-sulfonamide.
| Compound Name | 6-(dimethylamino)-N-(3,4-dimethylphenyl)-2-oxo-3,4-dihydro-1H-quinoline-7-sulfonamide |
|---|---|
| PubChem CID | 44634848 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 6-(dimethylamino)-N-(3,4-dimethylphenyl)-2-oxo-3,4-dihydro-1H-quinoline-7-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc3c(cc2N(C)C)CCC(=O)N3)cc1C |
| InChI | InChI=1S/C19H23N3O3S/c1-12-5-7-15(9-13(12)2)21-26(24,25)18-11-16-14(6-8-19(23)20-16)10-17(18)22(3)4/h5,7,9-11,21H,6,8H2,1-4H3,(H,20,23) |
| InChIKey | PNUCPERAJKCNDW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|