About 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride
5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride (PubChem CID 44635988) has the molecular formula C21H20ClN3S
and a molecular weight of 381.93 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride |
| PubChem CID | 44635988 |
| Molecular Formula | C21H20ClN3S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride |
| SMILES | Cc1ccc(Nc2ncnc3scc(-c4ccc(C)c(C)c4)c23)cc1.Cl |
| InChI | InChI=1S/C21H19N3S.ClH/c1-13-4-8-17(9-5-13)24-20-19-18(11-25-21(19)23-12-22-20)16-7-6-14(2)15(3)10-16;/h4-12H,1-3H3,(H,22,23,24);1H |
| InChIKey | VTNOXSOMYXPWNW-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride?
The IUPAC name of 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride (CID 44635988) is 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride.
What is the SMILES notation for 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride?
The canonical SMILES for 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride is Cc1ccc(Nc2ncnc3scc(-c4ccc(C)c(C)c4)c23)cc1.Cl.
What is the InChIKey of 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride?
The InChIKey is VTNOXSOMYXPWNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3S.ClH/c1-13-4-8-17(9-5-13)24-20-19-18(11-25-21(19)23-12-22-20)16-7-6-14(2)15(3)10-16;/h4-12H,1-3H3,(H,22,23,24);1H.
What are the key properties of 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride?
5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride has a molecular weight of 381.93 g/mol, XLogP of 6.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethylphenyl)-N-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 44635988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).