C25H34N2O4S — CID 44636040
ethyl 6-methyl-2-[[2-(4-pentoxyanilino)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 44636040) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is ethyl 6-methyl-2-[[2-(4-pentoxyanilino)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-methyl-2-[[2-(4-pentoxyanilino)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 44636040 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | ethyl 6-methyl-2-[[2-(4-pentoxyanilino)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCCCOc1ccc(NCC(=O)Nc2sc3c(c2C(=O)OCC)CCC(C)C3)cc1 |
| InChI | InChI=1S/C25H34N2O4S/c1-4-6-7-14-31-19-11-9-18(10-12-19)26-16-22(28)27-24-23(25(29)30-5-2)20-13-8-17(3)15-21(20)32-24/h9-12,17,26H,4-8,13-16H2,1-3H3,(H,27,28) |
| InChIKey | SVEKSMRKIRHZBO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|