C21H30N2O3S — CID 44636655
pentyl 2-(7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetate (PubChem CID 44636655) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is pentyl 2-(7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetate.
| Compound Name | pentyl 2-(7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetate |
|---|---|
| PubChem CID | 44636655 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | pentyl 2-(7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetate |
| SMILES | CCCCCOC(=O)Cn1cnc2sc3c(c2c1=O)CCC(C(C)(C)C)C3 |
| InChI | InChI=1S/C21H30N2O3S/c1-5-6-7-10-26-17(24)12-23-13-22-19-18(20(23)25)15-9-8-14(21(2,3)4)11-16(15)27-19/h13-14H,5-12H2,1-4H3 |
| InChIKey | JHKKKWVUAIGMFR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|