C22H15F3N4O4S — CID 44640278
2-[5-(4-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 44640278) has the molecular formula C22H15F3N4O4S and a molecular weight of 488.45 g/mol. Its IUPAC name is 2-[5-(4-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[5-(4-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 44640278 |
| Molecular Formula | C22H15F3N4O4S |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 2-[5-(4-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccccc1C(F)(F)F)n1cnc2scc(-c3ccc([N+](=O)[O-])cc3)c2c1=O |
| InChI | InChI=1S/C22H15F3N4O4S/c1-12(19(30)27-17-5-3-2-4-16(17)22(23,24)25)28-11-26-20-18(21(28)31)15(10-34-20)13-6-8-14(9-7-13)29(32)33/h2-12H,1H3,(H,27,30) |
| InChIKey | LRIFARKQZWQXMW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|