About 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide
6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide (PubChem CID 44654521) has the molecular formula C6H6Br2N2S
and a molecular weight of 298.00 g/mol. Its IUPAC name is 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide.
Molecular Properties
| Compound Name | 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide |
| PubChem CID | 44654521 |
| Molecular Formula | C6H6Br2N2S |
| Molecular Weight | 298.00 g/mol |
| Exact Mass | 295.86 |
| IUPAC Name | 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide |
| SMILES | Br.BrCc1cn2ccsc2n1 |
| InChI | InChI=1S/C6H5BrN2S.BrH/c7-3-5-4-9-1-2-10-6(9)8-5;/h1-2,4H,3H2;1H |
| InChIKey | XINQGNGWQODEQU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.00 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide?
The IUPAC name of 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide (CID 44654521) is 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide.
What is the SMILES notation for 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide?
The canonical SMILES for 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide is Br.BrCc1cn2ccsc2n1.
What is the InChIKey of 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide?
The InChIKey is XINQGNGWQODEQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrN2S.BrH/c7-3-5-4-9-1-2-10-6(9)8-5;/h1-2,4H,3H2;1H.
What are the key properties of 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide?
6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide has a molecular weight of 298.00 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole;hydrobromide is sourced from PubChem (CID 44654521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).