About (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate
(2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate (PubChem CID 44654771) has the molecular formula C24H20ClN4O4P
and a molecular weight of 494.88 g/mol. Its IUPAC name is (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate.
Molecular Properties
| Compound Name | (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate |
| PubChem CID | 44654771 |
| Molecular Formula | C24H20ClN4O4P |
| Molecular Weight | 494.88 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate |
| SMILES | Nc1nn2cccnc2c1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H20N4P.ClHO4/c25-23-22(24-26-17-10-18-28(24)27-23)29(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2-1(3,4)5/h1-18H,(H2,25,27);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HKYGFDKHRDKVFB-UHFFFAOYSA-M |
| XLogP | -1.83 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.88 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate?
The IUPAC name of (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate (CID 44654771) is (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate.
What is the SMILES notation for (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate?
The canonical SMILES for (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate is Nc1nn2cccnc2c1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate?
The InChIKey is HKYGFDKHRDKVFB-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H20N4P.ClHO4/c25-23-22(24-26-17-10-18-28(24)27-23)29(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2-1(3,4)5/h1-18H,(H2,25,27);(H,2,3,4,5)/q+1;/p-1.
What are the key properties of (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate?
(2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate has a molecular weight of 494.88 g/mol, XLogP of -1.83, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminopyrazolo[1,5-a]pyrimidin-3-yl)-triphenylphosphanium perchlorate is sourced from PubChem (CID 44654771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).