C19H21ClN2O2 — CID 44654932
(11S,12E,17S)-12-ethylidene-6-hydroxy-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde chloride (PubChem CID 44654932) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is (11S,12E,17S)-12-ethylidene-6-hydroxy-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde chloride.
| Compound Name | (11S,12E,17S)-12-ethylidene-6-hydroxy-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde chloride |
|---|---|
| PubChem CID | 44654932 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (11S,12E,17S)-12-ethylidene-6-hydroxy-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carbaldehyde chloride |
| SMILES | C/C=C1/C[NH+]2CCC34C(=C(C=O)[C@H]1C[C@H]23)Nc1c(O)cccc14.[Cl-] |
| InChI | InChI=1S/C19H20N2O2.ClH/c1-2-11-9-21-7-6-19-14-4-3-5-15(23)17(14)20-18(19)13(10-22)12(11)8-16(19)21;/h2-5,10,12,16,20,23H,6-9H2,1H3;1H/b11-2-;/t12-,16-,19?;/m0./s1 |
| InChIKey | MSYCTAZYGZJIIZ-NSKHBYARSA-N |
| XLogP | -1.85 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|