C18H20ClNO4 — CID 44654942
5-phenyl-2,3,7,8,9,10-hexahydro-1H-pyrrolo[2,1-a]isoquinolin-4-ium perchlorate (PubChem CID 44654942) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is 5-phenyl-2,3,7,8,9,10-hexahydro-1H-pyrrolo[2,1-a]isoquinolin-4-ium perchlorate.
| Compound Name | 5-phenyl-2,3,7,8,9,10-hexahydro-1H-pyrrolo[2,1-a]isoquinolin-4-ium perchlorate |
|---|---|
| PubChem CID | 44654942 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 5-phenyl-2,3,7,8,9,10-hexahydro-1H-pyrrolo[2,1-a]isoquinolin-4-ium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2cc3c(c4[n+]2CCC4)CCCC3)cc1 |
| InChI | InChI=1S/C18H20N.ClHO4/c1-2-7-14(8-3-1)18-13-15-9-4-5-10-16(15)17-11-6-12-19(17)18;2-1(3,4)5/h1-3,7-8,13H,4-6,9-12H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | VYKQBXCJKOOZER-UHFFFAOYSA-M |
| XLogP | -1.29 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|