C11H10BrN3O2S — CID 44654976
3-(4-nitrophenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazol-4-ium bromide (PubChem CID 44654976) has the molecular formula C11H10BrN3O2S and a molecular weight of 328.19 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazol-4-ium bromide.
| Compound Name | 3-(4-nitrophenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazol-4-ium bromide |
|---|---|
| PubChem CID | 44654976 |
| Molecular Formula | C11H10BrN3O2S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 3-(4-nitrophenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazol-4-ium bromide |
| SMILES | O=[N+]([O-])c1ccc(-c2csc3[n+]2CCN3)cc1.[Br-] |
| InChI | InChI=1S/C11H9N3O2S.BrH/c15-14(16)9-3-1-8(2-4-9)10-7-17-11-12-5-6-13(10)11;/h1-4,7H,5-6H2;1H |
| InChIKey | UXNNSWCGPRLSJP-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|