C21H17F4NO8 — CID 44655254
[(1R)-1-carboxyethyl]-[[3-(4-fluorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]methyl]azanium;2,2,2-trifluoroacetate (PubChem CID 44655254) has the molecular formula C21H17F4NO8 and a molecular weight of 487.36 g/mol. Its IUPAC name is [(1R)-1-carboxyethyl]-[[3-(4-fluorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]methyl]azanium;2,2,2-trifluoroacetate.
| Compound Name | [(1R)-1-carboxyethyl]-[[3-(4-fluorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]methyl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 44655254 |
| Molecular Formula | C21H17F4NO8 |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | [(1R)-1-carboxyethyl]-[[3-(4-fluorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]methyl]azanium;2,2,2-trifluoroacetate |
| SMILES | C[C@@H]([NH2+]Cc1c(O)cc(O)c2c(=O)c(-c3ccc(F)cc3)coc12)C(=O)O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C19H16FNO6.C2HF3O2/c1-9(19(25)26)21-7-12-14(22)6-15(23)16-17(24)13(8-27-18(12)16)10-2-4-11(20)5-3-10;3-2(4,5)1(6)7/h2-6,8-9,21-23H,7H2,1H3,(H,25,26);(H,6,7)/t9-;/m1./s1 |
| InChIKey | OYXFLQAYPOBDLS-SBSPUUFOSA-N |
| XLogP | 0.85 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|