C18H20ClN3 — CID 44655384
10-[(4-methylphenyl)methyl]-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium chloride (PubChem CID 44655384) has the molecular formula C18H20ClN3 and a molecular weight of 313.83 g/mol. Its IUPAC name is 10-[(4-methylphenyl)methyl]-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium chloride.
| Compound Name | 10-[(4-methylphenyl)methyl]-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium chloride |
|---|---|
| PubChem CID | 44655384 |
| Molecular Formula | C18H20ClN3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 10-[(4-methylphenyl)methyl]-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium chloride |
| SMILES | Cc1ccc(Cn2c3[n+](c4ccccc42)CCCN3)cc1.[Cl-] |
| InChI | InChI=1S/C18H19N3.ClH/c1-14-7-9-15(10-8-14)13-21-17-6-3-2-5-16(17)20-12-4-11-19-18(20)21;/h2-3,5-10H,4,11-13H2,1H3;1H |
| InChIKey | OBULTYYLTACRQO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 20.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|