About [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide
[1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide (PubChem CID 44655880) has the molecular formula C18H33IN2O3
and a molecular weight of 452.38 g/mol. Its IUPAC name is [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide.
Molecular Properties
| Compound Name | [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide |
| PubChem CID | 44655880 |
| Molecular Formula | C18H33IN2O3 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide |
| SMILES | CCCCCC(=O)OC(CN1CCCC1=O)C[NH+]1CCCCC1.[I-] |
| InChI | InChI=1S/C18H32N2O3.HI/c1-2-3-5-10-18(22)23-16(14-19-11-6-4-7-12-19)15-20-13-8-9-17(20)21;/h16H,2-15H2,1H3;1H |
| InChIKey | YOMHULUDKOOULG-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide?
The IUPAC name of [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide (CID 44655880) is [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide.
What is the SMILES notation for [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide?
The canonical SMILES for [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide is CCCCCC(=O)OC(CN1CCCC1=O)C[NH+]1CCCCC1.[I-].
What is the InChIKey of [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide?
The InChIKey is YOMHULUDKOOULG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O3.HI/c1-2-3-5-10-18(22)23-16(14-19-11-6-4-7-12-19)15-20-13-8-9-17(20)21;/h16H,2-15H2,1H3;1H.
What are the key properties of [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide?
[1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide has a molecular weight of 452.38 g/mol, XLogP of -1.83, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-oxopyrrolidin-1-yl)-3-piperidin-1-ium-1-ylpropan-2-yl] hexanoate iodide is sourced from PubChem (CID 44655880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).