C25H41NO7 — CID 44655937
(1S,4S,5R,6S,8R,9S,10S,13S,16S,18S)-11-ethyl-4,6,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-8,9,16-triol (PubChem CID 44655937) has the molecular formula C25H41NO7 and a molecular weight of 467.60 g/mol. Its IUPAC name is (1S,4S,5R,6S,8R,9S,10S,13S,16S,18S)-11-ethyl-4,6,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-8,9,16-triol.
| Compound Name | (1S,4S,5R,6S,8R,9S,10S,13S,16S,18S)-11-ethyl-4,6,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-8,9,16-triol |
|---|---|
| PubChem CID | 44655937 |
| Molecular Formula | C25H41NO7 |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | (1S,4S,5R,6S,8R,9S,10S,13S,16S,18S)-11-ethyl-4,6,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-8,9,16-triol |
| SMILES | CCN1C[C@]2(COC)CC[C@H](O)[C@@]34C5C[C@H]6C(OC)C5[C@](O)(C[C@@H]6OC)[C@@](O)(C(OC)C23)[C@@H]14 |
| InChI | InChI=1S/C25H41NO7/c1-6-26-11-22(12-30-2)8-7-16(27)24-14-9-13-15(31-3)10-23(28,17(14)18(13)32-4)25(29,21(24)26)20(33-5)19(22)24/h13-21,27-29H,6-12H2,1-5H3/t13-,14?,15+,16+,17?,18?,19?,20?,21+,22+,23-,24+,25-/m1/s1 |
| InChIKey | JVBLTQQBEQQLEV-CMWGANOBSA-N |
| XLogP | 0.27 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |