C19H20BrN3O2 — CID 44656006
1-(3-methoxyphenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone bromide (PubChem CID 44656006) has the molecular formula C19H20BrN3O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone bromide.
| Compound Name | 1-(3-methoxyphenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone bromide |
|---|---|
| PubChem CID | 44656006 |
| Molecular Formula | C19H20BrN3O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone bromide |
| SMILES | COc1cccc(C(=O)Cn2c3[n+](c4ccccc42)CCCN3)c1.[Br-] |
| InChI | InChI=1S/C19H19N3O2.BrH/c1-24-15-7-4-6-14(12-15)18(23)13-22-17-9-3-2-8-16(17)21-11-5-10-20-19(21)22;/h2-4,6-9,12H,5,10-11,13H2,1H3;1H |
| InChIKey | DRQPOWLJAQDLKV-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|