About 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride
2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride (PubChem CID 44656037) has the molecular formula C12H22ClN7
and a molecular weight of 299.81 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride.
Molecular Properties
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride |
| PubChem CID | 44656037 |
| Molecular Formula | C12H22ClN7 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride |
| SMILES | Cc1cc(C)nc(/N=C(\N)NN2CC[NH+](C)CC2)n1.[Cl-] |
| InChI | InChI=1S/C12H21N7.ClH/c1-9-8-10(2)15-12(14-9)16-11(13)17-19-6-4-18(3)5-7-19;/h8H,4-7H2,1-3H3,(H3,13,14,15,16,17);1H |
| InChIKey | VIDSFMOXYYLUOB-UHFFFAOYSA-N |
| XLogP | -4.62 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride?
The IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride (CID 44656037) is 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride.
What is the SMILES notation for 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride?
The canonical SMILES for 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride is Cc1cc(C)nc(/N=C(\N)NN2CC[NH+](C)CC2)n1.[Cl-].
What is the InChIKey of 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride?
The InChIKey is VIDSFMOXYYLUOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N7.ClH/c1-9-8-10(2)15-12(14-9)16-11(13)17-19-6-4-18(3)5-7-19;/h8H,4-7H2,1-3H3,(H3,13,14,15,16,17);1H.
What are the key properties of 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride?
2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride has a molecular weight of 299.81 g/mol, XLogP of -4.62, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylpiperazin-4-ium-1-yl)guanidine chloride is sourced from PubChem (CID 44656037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).