About acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide
acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 44656049) has the molecular formula C17H17N3O3S
and a molecular weight of 343.41 g/mol. Its IUPAC name is acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide |
| PubChem CID | 44656049 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | CC(=O)O.Cc1[nH]c(=S)c(C#N)c(C)c1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H13N3OS.C2H4O2/c1-9-12(8-16)15(20)17-10(2)13(9)14(19)18-11-6-4-3-5-7-11;1-2(3)4/h3-7H,1-2H3,(H,17,20)(H,18,19);1H3,(H,3,4) |
| InChIKey | PEVOCXIOWUZGCE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide?
The IUPAC name of acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide (CID 44656049) is acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide.
What is the SMILES notation for acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide?
The canonical SMILES for acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide is CC(=O)O.Cc1[nH]c(=S)c(C#N)c(C)c1C(=O)Nc1ccccc1.
What is the InChIKey of acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide?
The InChIKey is PEVOCXIOWUZGCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3OS.C2H4O2/c1-9-12(8-16)15(20)17-10(2)13(9)14(19)18-11-6-4-3-5-7-11;1-2(3)4/h3-7H,1-2H3,(H,17,20)(H,18,19);1H3,(H,3,4).
What are the key properties of acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide?
acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide has a molecular weight of 343.41 g/mol, XLogP of 3.58, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;5-cyano-2,4-dimethyl-N-phenyl-6-sulfanylidene-1H-pyridine-3-carboxamide is sourced from PubChem (CID 44656049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).